C13H21FN2 — CID 80544158
N-[(3-fluorophenyl)methyl]-N,2-dimethylbutane-1,4-diamine (PubChem CID 80544158) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N,2-dimethylbutane-1,4-diamine.
| Compound Name | N-[(3-fluorophenyl)methyl]-N,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 80544158 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N,2-dimethylbutane-1,4-diamine |
| SMILES | CC(CCN)CN(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C13H21FN2/c1-11(6-7-15)9-16(2)10-12-4-3-5-13(14)8-12/h3-5,8,11H,6-7,9-10,15H2,1-2H3 |
| InChIKey | HYJDOLXMTPEWNX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |