About 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine
3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine (PubChem CID 80544419) has the molecular formula C14H23N5
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine |
| PubChem CID | 80544419 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine |
| SMILES | CCn1nc(C)c(-c2cnc(C(C)CCN)[nH]2)c1C |
| InChI | InChI=1S/C14H23N5/c1-5-19-11(4)13(10(3)18-19)12-8-16-14(17-12)9(2)6-7-15/h8-9H,5-7,15H2,1-4H3,(H,16,17) |
| InChIKey | VHFWKIWNNNQSMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine?
The IUPAC name of 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine (CID 80544419) is 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine.
What is the SMILES notation for 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine?
The canonical SMILES for 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine is CCn1nc(C)c(-c2cnc(C(C)CCN)[nH]2)c1C.
What is the InChIKey of 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine?
The InChIKey is VHFWKIWNNNQSMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5/c1-5-19-11(4)13(10(3)18-19)12-8-16-14(17-12)9(2)6-7-15/h8-9H,5-7,15H2,1-4H3,(H,16,17).
What are the key properties of 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine?
3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine has a molecular weight of 261.37 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]butan-1-amine is sourced from PubChem (CID 80544419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).