C8H6ClF5N2OS — CID 80544548
4-chloro-2-methylsulfanyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidine (PubChem CID 80544548) has the molecular formula C8H6ClF5N2OS and a molecular weight of 308.66 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidine.
| Compound Name | 4-chloro-2-methylsulfanyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidine |
|---|---|
| PubChem CID | 80544548 |
| Molecular Formula | C8H6ClF5N2OS |
| Molecular Weight | 308.66 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 4-chloro-2-methylsulfanyl-6-(2,2,3,3,3-pentafluoropropoxy)pyrimidine |
| SMILES | CSc1nc(Cl)cc(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H6ClF5N2OS/c1-18-6-15-4(9)2-5(16-6)17-3-7(10,11)8(12,13)14/h2H,3H2,1H3 |
| InChIKey | WRLJVUKTQFFPSP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|