C8H7ClF4N2OS — CID 80544644
4-chloro-2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine (PubChem CID 80544644) has the molecular formula C8H7ClF4N2OS and a molecular weight of 290.67 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine.
| Compound Name | 4-chloro-2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine |
|---|---|
| PubChem CID | 80544644 |
| Molecular Formula | C8H7ClF4N2OS |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 4-chloro-2-methylsulfanyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine |
| SMILES | CSc1nc(Cl)cc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H7ClF4N2OS/c1-17-7-14-4(9)2-5(15-7)16-3-8(12,13)6(10)11/h2,6H,3H2,1H3 |
| InChIKey | NPPYMZAUARPLNS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|