C14H13F3N2O2 — CID 80546389
ethyl (E)-4-[4-cyano-3-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 80546389) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl (E)-4-[4-cyano-3-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | ethyl (E)-4-[4-cyano-3-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 80546389 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl (E)-4-[4-cyano-3-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-2-21-13(20)4-3-7-19-11-6-5-10(9-18)12(8-11)14(15,16)17/h3-6,8,19H,2,7H2,1H3/b4-3+ |
| InChIKey | SQGDZAMGXNMRNV-ONEGZZNKSA-N |
| XLogP | 3.11 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|