C15H20F2N2O2 — CID 80546612
4-[4-(ethylaminomethyl)piperidin-1-yl]-2,3-difluorobenzoic acid (PubChem CID 80546612) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-[4-(ethylaminomethyl)piperidin-1-yl]-2,3-difluorobenzoic acid.
| Compound Name | 4-[4-(ethylaminomethyl)piperidin-1-yl]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 80546612 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-[4-(ethylaminomethyl)piperidin-1-yl]-2,3-difluorobenzoic acid |
| SMILES | CCNCC1CCN(c2ccc(C(=O)O)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-18-9-10-5-7-19(8-6-10)12-4-3-11(15(20)21)13(16)14(12)17/h3-4,10,18H,2,5-9H2,1H3,(H,20,21) |
| InChIKey | XAIJNHDOSIVCLA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |