C14H23NO3 — CID 80546657
ethyl (E)-4-(5,5-dimethyl-2-oxoazepan-1-yl)but-2-enoate (PubChem CID 80546657) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethyl (E)-4-(5,5-dimethyl-2-oxoazepan-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(5,5-dimethyl-2-oxoazepan-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 80546657 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethyl (E)-4-(5,5-dimethyl-2-oxoazepan-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1CCC(C)(C)CCC1=O |
| InChI | InChI=1S/C14H23NO3/c1-4-18-13(17)6-5-10-15-11-9-14(2,3)8-7-12(15)16/h5-6H,4,7-11H2,1-3H3/b6-5+ |
| InChIKey | YOERHHPACRSAQX-AATRIKPKSA-N |
| XLogP | 2.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|