C14H22ClN3OS — CID 80547172
1-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol (PubChem CID 80547172) has the molecular formula C14H22ClN3OS and a molecular weight of 315.87 g/mol. Its IUPAC name is 1-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol.
| Compound Name | 1-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 80547172 |
| Molecular Formula | C14H22ClN3OS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]-4-ethylcyclohexan-1-ol |
| SMILES | CCC1CCC(O)(CNc2cc(Cl)nc(SC)n2)CC1 |
| InChI | InChI=1S/C14H22ClN3OS/c1-3-10-4-6-14(19,7-5-10)9-16-12-8-11(15)17-13(18-12)20-2/h8,10,19H,3-7,9H2,1-2H3,(H,16,17,18) |
| InChIKey | DRKSTSAVPGONQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |