About ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate
ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate (PubChem CID 80547438) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate |
| PubChem CID | 80547438 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO2/c1-4-21-15(20)6-5-7-19-18-10-14-8-16(2,12-18)11-17(3,9-14)13-18/h5-6,14,19H,4,7-13H2,1-3H3/b6-5+ |
| InChIKey | QVDGLNUWFFFIEU-AATRIKPKSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate?
The IUPAC name of ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate (CID 80547438) is ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate.
What is the SMILES notation for ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate?
The canonical SMILES for ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate is CCOC(=O)/C=C/CNC12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate?
The InChIKey is QVDGLNUWFFFIEU-AATRIKPKSA-N. The full InChI is InChI=1S/C18H29NO2/c1-4-21-15(20)6-5-7-19-18-10-14-8-16(2,12-18)11-17(3,9-14)13-18/h5-6,14,19H,4,7-13H2,1-3H3/b6-5+.
What are the key properties of ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate?
ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate has a molecular weight of 291.44 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-[(3,5-dimethyl-1-adamantyl)amino]but-2-enoate is sourced from PubChem (CID 80547438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).