C16H32N4O — CID 80547764
1-(4-butan-2-ylpiperazin-1-yl)-2-methyl-2-piperazin-1-ylpropan-1-one (PubChem CID 80547764) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-(4-butan-2-ylpiperazin-1-yl)-2-methyl-2-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-methyl-2-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 80547764 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-methyl-2-piperazin-1-ylpropan-1-one |
| SMILES | CCC(C)N1CCN(C(=O)C(C)(C)N2CCNCC2)CC1 |
| InChI | InChI=1S/C16H32N4O/c1-5-14(2)18-10-12-19(13-11-18)15(21)16(3,4)20-8-6-17-7-9-20/h14,17H,5-13H2,1-4H3 |
| InChIKey | JNSUYAGWJLWXRO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |