C14H26N2O2 — CID 80547894
ethyl (E)-4-[2-[cyclopentyl(methyl)amino]ethylamino]but-2-enoate (PubChem CID 80547894) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is ethyl (E)-4-[2-[cyclopentyl(methyl)amino]ethylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[2-[cyclopentyl(methyl)amino]ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 80547894 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | ethyl (E)-4-[2-[cyclopentyl(methyl)amino]ethylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCN(C)C1CCCC1 |
| InChI | InChI=1S/C14H26N2O2/c1-3-18-14(17)9-6-10-15-11-12-16(2)13-7-4-5-8-13/h6,9,13,15H,3-5,7-8,10-12H2,1-2H3/b9-6+ |
| InChIKey | KFYYKETZSZDTIZ-RMKNXTFCSA-N |
| XLogP | 1.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|