C14H15N5O2 — CID 80548078
3-nitro-6-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)pyridine-2,6-diamine (PubChem CID 80548078) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-nitro-6-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)pyridine-2,6-diamine.
| Compound Name | 3-nitro-6-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80548078 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-nitro-6-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)pyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2cccc3c2CCNC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O2/c15-14-12(19(20)21)4-5-13(18-14)17-11-3-1-2-9-8-16-7-6-10(9)11/h1-5,16H,6-8H2,(H3,15,17,18) |
| InChIKey | OSCZFZCYBPLAFB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|