About 2-butyl-4,6-dichloro-5-fluoropyrimidine
2-butyl-4,6-dichloro-5-fluoropyrimidine (PubChem CID 80550184) has the molecular formula C8H9Cl2FN2
and a molecular weight of 223.08 g/mol. Its IUPAC name is 2-butyl-4,6-dichloro-5-fluoropyrimidine.
Molecular Properties
| Compound Name | 2-butyl-4,6-dichloro-5-fluoropyrimidine |
| PubChem CID | 80550184 |
| Molecular Formula | C8H9Cl2FN2 |
| Molecular Weight | 223.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 2-butyl-4,6-dichloro-5-fluoropyrimidine |
| SMILES | CCCCc1nc(Cl)c(F)c(Cl)n1 |
| InChI | InChI=1S/C8H9Cl2FN2/c1-2-3-4-5-12-7(9)6(11)8(10)13-5/h2-4H2,1H3 |
| InChIKey | WATPESIHYATXSG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.08 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-4,6-dichloro-5-fluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,6-dichloro-5-fluoropyrimidine?
The IUPAC name of 2-butyl-4,6-dichloro-5-fluoropyrimidine (CID 80550184) is 2-butyl-4,6-dichloro-5-fluoropyrimidine.
What is the SMILES notation for 2-butyl-4,6-dichloro-5-fluoropyrimidine?
The canonical SMILES for 2-butyl-4,6-dichloro-5-fluoropyrimidine is CCCCc1nc(Cl)c(F)c(Cl)n1.
What is the InChIKey of 2-butyl-4,6-dichloro-5-fluoropyrimidine?
The InChIKey is WATPESIHYATXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2FN2/c1-2-3-4-5-12-7(9)6(11)8(10)13-5/h2-4H2,1H3.
What are the key properties of 2-butyl-4,6-dichloro-5-fluoropyrimidine?
2-butyl-4,6-dichloro-5-fluoropyrimidine has a molecular weight of 223.08 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,6-dichloro-5-fluoropyrimidine is sourced from PubChem (CID 80550184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).