About 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione
2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione (PubChem CID 80550724) has the molecular formula C9H14FN3O2
and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione.
Molecular Properties
| Compound Name | 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione |
| PubChem CID | 80550724 |
| Molecular Formula | C9H14FN3O2 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione |
| SMILES | CC(C)(C)C(N)C1=NC(=O)C(F)C(=O)N1 |
| InChI | InChI=1S/C9H14FN3O2/c1-9(2,3)5(11)6-12-7(14)4(10)8(15)13-6/h4-5H,11H2,1-3H3,(H,12,13,14,15) |
| InChIKey | TULQBYZJCHQAOD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione?
The IUPAC name of 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione (CID 80550724) is 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione.
What is the SMILES notation for 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione?
The canonical SMILES for 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione is CC(C)(C)C(N)C1=NC(=O)C(F)C(=O)N1.
What is the InChIKey of 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione?
The InChIKey is TULQBYZJCHQAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O2/c1-9(2,3)5(11)6-12-7(14)4(10)8(15)13-6/h4-5H,11H2,1-3H3,(H,12,13,14,15).
What are the key properties of 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione?
2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione has a molecular weight of 215.23 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-amino-2,2-dimethylpropyl)-5-fluoro-1H-pyrimidine-4,6-dione is sourced from PubChem (CID 80550724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).