C9H12FN3O2 — CID 80550912
5-fluoro-4-hydroxy-2-piperidin-4-yl-1H-pyrimidin-6-one (PubChem CID 80550912) has the molecular formula C9H12FN3O2 and a molecular weight of 213.21 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-2-piperidin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-hydroxy-2-piperidin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80550912 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-fluoro-4-hydroxy-2-piperidin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CCNCC2)nc(O)c1F |
| InChI | InChI=1S/C9H12FN3O2/c10-6-8(14)12-7(13-9(6)15)5-1-3-11-4-2-5/h5,11H,1-4H2,(H2,12,13,14,15) |
| InChIKey | JGOQSNFKTKMYJP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |