About 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine
4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine (PubChem CID 80550935) has the molecular formula C13H11Cl2FN2O3
and a molecular weight of 333.15 g/mol. Its IUPAC name is 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine |
| PubChem CID | 80550935 |
| Molecular Formula | C13H11Cl2FN2O3 |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2nc(Cl)c(F)c(Cl)n2)c(OC)c1OC |
| InChI | InChI=1S/C13H11Cl2FN2O3/c1-19-7-5-4-6(9(20-2)10(7)21-3)13-17-11(14)8(16)12(15)18-13/h4-5H,1-3H3 |
| InChIKey | DCOYIJBCVYBRFU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine?
The IUPAC name of 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine (CID 80550935) is 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine.
What is the SMILES notation for 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine?
The canonical SMILES for 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine is COc1ccc(-c2nc(Cl)c(F)c(Cl)n2)c(OC)c1OC.
What is the InChIKey of 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine?
The InChIKey is DCOYIJBCVYBRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2FN2O3/c1-19-7-5-4-6(9(20-2)10(7)21-3)13-17-11(14)8(16)12(15)18-13/h4-5H,1-3H3.
What are the key properties of 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine?
4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine has a molecular weight of 333.15 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-5-fluoro-2-(2,3,4-trimethoxyphenyl)pyrimidine is sourced from PubChem (CID 80550935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).