C7H10FN3O2 — CID 80551006
2-(2-aminopropyl)-5-fluoro-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 80551006) has the molecular formula C7H10FN3O2 and a molecular weight of 187.17 g/mol. Its IUPAC name is 2-(2-aminopropyl)-5-fluoro-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(2-aminopropyl)-5-fluoro-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80551006 |
| Molecular Formula | C7H10FN3O2 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(2-aminopropyl)-5-fluoro-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CC(N)Cc1nc(O)c(F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10FN3O2/c1-3(9)2-4-10-6(12)5(8)7(13)11-4/h3H,2,9H2,1H3,(H2,10,11,12,13) |
| InChIKey | QLFSZZRBOQRAOL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |