About N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine
N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine (PubChem CID 80551253) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine |
| PubChem CID | 80551253 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine |
| SMILES | CCC(C)N(C)CC(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C13H29N3/c1-6-12(2)15(5)11-13(3,4)16-9-7-14-8-10-16/h12,14H,6-11H2,1-5H3 |
| InChIKey | HPPZFQQXDYWSKW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine?
The IUPAC name of N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine (CID 80551253) is N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine.
What is the SMILES notation for N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine?
The canonical SMILES for N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine is CCC(C)N(C)CC(C)(C)N1CCNCC1.
What is the InChIKey of N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine?
The InChIKey is HPPZFQQXDYWSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-6-12(2)15(5)11-13(3,4)16-9-7-14-8-10-16/h12,14H,6-11H2,1-5H3.
What are the key properties of N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine?
N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine has a molecular weight of 227.40 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N,2-dimethyl-2-piperazin-1-ylpropan-1-amine is sourced from PubChem (CID 80551253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).