C15H22BrClN2 — CID 80551575
N-[[1-[(2-bromo-5-chlorophenyl)methyl]piperidin-4-yl]methyl]ethanamine (PubChem CID 80551575) has the molecular formula C15H22BrClN2 and a molecular weight of 345.71 g/mol. Its IUPAC name is N-[[1-[(2-bromo-5-chlorophenyl)methyl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(2-bromo-5-chlorophenyl)methyl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80551575 |
| Molecular Formula | C15H22BrClN2 |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[[1-[(2-bromo-5-chlorophenyl)methyl]piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNCC1CCN(Cc2cc(Cl)ccc2Br)CC1 |
| InChI | InChI=1S/C15H22BrClN2/c1-2-18-10-12-5-7-19(8-6-12)11-13-9-14(17)3-4-15(13)16/h3-4,9,12,18H,2,5-8,10-11H2,1H3 |
| InChIKey | WTIXKTWENNDIKK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |