C17H29N3 — CID 80553136
N'-benzyl-N'-methyl-N-(piperidin-3-ylmethyl)propane-1,3-diamine (PubChem CID 80553136) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N'-benzyl-N'-methyl-N-(piperidin-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-methyl-N-(piperidin-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 80553136 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N'-benzyl-N'-methyl-N-(piperidin-3-ylmethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCC1CCCNC1)Cc1ccccc1 |
| InChI | InChI=1S/C17H29N3/c1-20(15-16-7-3-2-4-8-16)12-6-11-19-14-17-9-5-10-18-13-17/h2-4,7-8,17-19H,5-6,9-15H2,1H3 |
| InChIKey | ALSLDFOVKMTDAO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|