C14H14N2OS — CID 80554577
N-(1,2,3,4-tetrahydroisoquinolin-5-yl)thiophene-3-carboxamide (PubChem CID 80554577) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroisoquinolin-5-yl)thiophene-3-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydroisoquinolin-5-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 80554577 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(1,2,3,4-tetrahydroisoquinolin-5-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1CCNC2)c1ccsc1 |
| InChI | InChI=1S/C14H14N2OS/c17-14(11-5-7-18-9-11)16-13-3-1-2-10-8-15-6-4-12(10)13/h1-3,5,7,9,15H,4,6,8H2,(H,16,17) |
| InChIKey | UVTCTIKWUDFSRU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |