C11H22N2O2 — CID 80555087
N-(1,4-dioxan-2-ylmethyl)-1-piperidin-3-ylmethanamine (PubChem CID 80555087) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-1-piperidin-3-ylmethanamine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-1-piperidin-3-ylmethanamine |
|---|---|
| PubChem CID | 80555087 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-1-piperidin-3-ylmethanamine |
| SMILES | C1CNCC(CNCC2COCCO2)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-10(6-12-3-1)7-13-8-11-9-14-4-5-15-11/h10-13H,1-9H2 |
| InChIKey | IZNKSAURSBADKL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |