C16H24N2O3 — CID 80555297
(2S)-2-[[2-(4-aminophenyl)-2-methylpropanoyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 80555297) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S)-2-[[2-(4-aminophenyl)-2-methylpropanoyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[2-(4-aminophenyl)-2-methylpropanoyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 80555297 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2S)-2-[[2-(4-aminophenyl)-2-methylpropanoyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C(=O)N[C@H](C(=O)O)C(C)(C)C)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-15(2,3)12(13(19)20)18-14(21)16(4,5)10-6-8-11(17)9-7-10/h6-9,12H,17H2,1-5H3,(H,18,21)(H,19,20)/t12-/m1/s1 |
| InChIKey | JERMVRTXPQTXHF-GFCCVEGCSA-N |
| XLogP | 2.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|