C14H20F2N2 — CID 80555516
2-(3,5-difluorophenyl)-N-(piperidin-3-ylmethyl)ethanamine (PubChem CID 80555516) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-(piperidin-3-ylmethyl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-N-(piperidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80555516 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-(piperidin-3-ylmethyl)ethanamine |
| SMILES | Fc1cc(F)cc(CCNCC2CCCNC2)c1 |
| InChI | InChI=1S/C14H20F2N2/c15-13-6-11(7-14(16)8-13)3-5-18-10-12-2-1-4-17-9-12/h6-8,12,17-18H,1-5,9-10H2 |
| InChIKey | DJINYAUTHJKEAS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|