C14H9F3O2S — CID 80556469
3-[(2,3-difluorophenyl)methylsulfanyl]-4-fluorobenzoic acid (PubChem CID 80556469) has the molecular formula C14H9F3O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methylsulfanyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(2,3-difluorophenyl)methylsulfanyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 80556469 |
| Molecular Formula | C14H9F3O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methylsulfanyl]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(SCc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C14H9F3O2S/c15-10-5-4-8(14(18)19)6-12(10)20-7-9-2-1-3-11(16)13(9)17/h1-6H,7H2,(H,18,19) |
| InChIKey | YBXWTCXKBASXQV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |