About 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline
4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline (PubChem CID 80556525) has the molecular formula C16H26N2S
and a molecular weight of 278.47 g/mol. Its IUPAC name is 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline |
| PubChem CID | 80556525 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline |
| SMILES | CC1CN(CC(C)(C)c2ccc(N)cc2)CC(C)S1 |
| InChI | InChI=1S/C16H26N2S/c1-12-9-18(10-13(2)19-12)11-16(3,4)14-5-7-15(17)8-6-14/h5-8,12-13H,9-11,17H2,1-4H3 |
| InChIKey | FUQCLLMOWGTFPW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline?
The IUPAC name of 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline (CID 80556525) is 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline.
What is the SMILES notation for 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline?
The canonical SMILES for 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline is CC1CN(CC(C)(C)c2ccc(N)cc2)CC(C)S1.
What is the InChIKey of 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline?
The InChIKey is FUQCLLMOWGTFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2S/c1-12-9-18(10-13(2)19-12)11-16(3,4)14-5-7-15(17)8-6-14/h5-8,12-13H,9-11,17H2,1-4H3.
What are the key properties of 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline?
4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline has a molecular weight of 278.47 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,6-dimethylthiomorpholin-4-yl)-2-methylpropan-2-yl]aniline is sourced from PubChem (CID 80556525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).