C15H21N3O — CID 80556874
2-(4-aminophenyl)-N-(2-cyanopropyl)-N,2-dimethylpropanamide (PubChem CID 80556874) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(2-cyanopropyl)-N,2-dimethylpropanamide.
| Compound Name | 2-(4-aminophenyl)-N-(2-cyanopropyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 80556874 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(4-aminophenyl)-N-(2-cyanopropyl)-N,2-dimethylpropanamide |
| SMILES | CC(C#N)CN(C)C(=O)C(C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-11(9-16)10-18(4)14(19)15(2,3)12-5-7-13(17)8-6-12/h5-8,11H,10,17H2,1-4H3 |
| InChIKey | HPIDFTIGWUMELG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|