C12H10FNO2S2 — CID 80557010
3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid (PubChem CID 80557010) has the molecular formula C12H10FNO2S2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 80557010 |
| Molecular Formula | C12H10FNO2S2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid |
| SMILES | CCc1csc(Sc2cc(C(=O)O)ccc2F)n1 |
| InChI | InChI=1S/C12H10FNO2S2/c1-2-8-6-17-12(14-8)18-10-5-7(11(15)16)3-4-9(10)13/h3-6H,2H2,1H3,(H,15,16) |
| InChIKey | CGEBOYVZCLWTDE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |