3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid

C12H10FNO2S2 — CID 80557010

IUPAC3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid
SMILESCCc1csc(Sc2cc(C(=O)O)ccc2F)n1
InChIInChI=1S/C12H10FNO2S2/c1-2-8-6-17-12(14-8)18-10-5-7(11(15)16)3-4-9(10)13/h3-6H,2H2,1H3,(H,15,16)
InChIKeyCGEBOYVZCLWTDE-UHFFFAOYSA-N
MW283.35 g/mol
LogP3.69
Rot. Bonds4

About 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid

3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid (PubChem CID 80557010) has the molecular formula C12H10FNO2S2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid.

Molecular Properties

Compound Name3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid
PubChem CID80557010
Molecular FormulaC12H10FNO2S2
Molecular Weight283.35 g/mol
Exact Mass283.01
IUPAC Name3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid
SMILESCCc1csc(Sc2cc(C(=O)O)ccc2F)n1
InChIInChI=1S/C12H10FNO2S2/c1-2-8-6-17-12(14-8)18-10-5-7(11(15)16)3-4-9(10)13/h3-6H,2H2,1H3,(H,15,16)
InChIKeyCGEBOYVZCLWTDE-UHFFFAOYSA-N
XLogP3.69
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid?
The IUPAC name of 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid (CID 80557010) is 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid.
What is the SMILES notation for 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid?
The canonical SMILES for 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid is CCc1csc(Sc2cc(C(=O)O)ccc2F)n1.
What is the InChIKey of 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid?
The InChIKey is CGEBOYVZCLWTDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO2S2/c1-2-8-6-17-12(14-8)18-10-5-7(11(15)16)3-4-9(10)13/h3-6H,2H2,1H3,(H,15,16).
What are the key properties of 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid?
3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid has a molecular weight of 283.35 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-1,3-thiazol-2-yl)sulfanyl]-4-fluorobenzoic acid is sourced from PubChem (CID 80557010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).