C16H26O2 — CID 80557783
1-(2-methoxy-5-methylphenyl)-2-methylheptan-2-ol (PubChem CID 80557783) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-2-methylheptan-2-ol.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 80557783 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-2-methylheptan-2-ol |
| SMILES | CCCCCC(C)(O)Cc1cc(C)ccc1OC |
| InChI | InChI=1S/C16H26O2/c1-5-6-7-10-16(3,17)12-14-11-13(2)8-9-15(14)18-4/h8-9,11,17H,5-7,10,12H2,1-4H3 |
| InChIKey | VRPGDKGJCUJGEO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|