C17H32N2S — CID 80558828
2-(4-tert-butyl-1,3-thiazol-2-yl)-N-propan-2-ylheptan-2-amine (PubChem CID 80558828) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-propan-2-ylheptan-2-amine.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-propan-2-ylheptan-2-amine |
|---|---|
| PubChem CID | 80558828 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-propan-2-ylheptan-2-amine |
| SMILES | CCCCCC(C)(NC(C)C)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C17H32N2S/c1-8-9-10-11-17(7,19-13(2)3)15-18-14(12-20-15)16(4,5)6/h12-13,19H,8-11H2,1-7H3 |
| InChIKey | GISSSFNHCZCITE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|