About 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol
3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol (PubChem CID 80559064) has the molecular formula C8H16F3NO
and a molecular weight of 199.22 g/mol. Its IUPAC name is 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol |
| PubChem CID | 80559064 |
| Molecular Formula | C8H16F3NO |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol |
| SMILES | CC(C)(C)NCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO/c1-6(2,3)12-5-7(4,13)8(9,10)11/h12-13H,5H2,1-4H3 |
| InChIKey | BRKPMBKTOAFIDN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol?
The IUPAC name of 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol (CID 80559064) is 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol.
What is the SMILES notation for 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol?
The canonical SMILES for 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol is CC(C)(C)NCC(C)(O)C(F)(F)F.
What is the InChIKey of 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol?
The InChIKey is BRKPMBKTOAFIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO/c1-6(2,3)12-5-7(4,13)8(9,10)11/h12-13H,5H2,1-4H3.
What are the key properties of 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol?
3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol has a molecular weight of 199.22 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tert-butylamino)-1,1,1-trifluoro-2-methylpropan-2-ol is sourced from PubChem (CID 80559064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).