C12H15N5 — CID 80559779
1-N-[3-(1,2,4-triazol-4-yl)phenyl]cyclobutane-1,3-diamine (PubChem CID 80559779) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 1-N-[3-(1,2,4-triazol-4-yl)phenyl]cyclobutane-1,3-diamine.
| Compound Name | 1-N-[3-(1,2,4-triazol-4-yl)phenyl]cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80559779 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-N-[3-(1,2,4-triazol-4-yl)phenyl]cyclobutane-1,3-diamine |
| SMILES | NC1CC(Nc2cccc(-n3cnnc3)c2)C1 |
| InChI | InChI=1S/C12H15N5/c13-9-4-11(5-9)16-10-2-1-3-12(6-10)17-7-14-15-8-17/h1-3,6-9,11,16H,4-5,13H2 |
| InChIKey | UBYOYYGEFHKNCA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |