About 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione
6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 805605) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| PubChem CID | 805605 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)c3cccc4c(N(C)C)ccc(c34)C2=O)c1 |
| InChI | InChI=1S/C22H20N2O2/c1-13-8-9-14(2)19(12-13)24-21(25)16-7-5-6-15-18(23(3)4)11-10-17(20(15)16)22(24)26/h5-12H,1-4H3 |
| InChIKey | JCDPBWOISZLLCZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione?
The IUPAC name of 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (CID 805605) is 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione.
What is the SMILES notation for 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione?
The canonical SMILES for 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione is Cc1ccc(C)c(N2C(=O)c3cccc4c(N(C)C)ccc(c34)C2=O)c1.
What is the InChIKey of 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione?
The InChIKey is JCDPBWOISZLLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-13-8-9-14(2)19(12-13)24-21(25)16-7-5-6-15-18(23(3)4)11-10-17(20(15)16)22(24)26/h5-12H,1-4H3.
What are the key properties of 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione?
6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione has a molecular weight of 344.41 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2-(2,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione is sourced from PubChem (CID 805605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).