About 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine
1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine (PubChem CID 80560812) has the molecular formula C12H16N6
and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine |
| PubChem CID | 80560812 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine |
| SMILES | Cc1ccc(NC2CC(N)C2)cc1-n1cnnn1 |
| InChI | InChI=1S/C12H16N6/c1-8-2-3-10(15-11-4-9(13)5-11)6-12(8)18-7-14-16-17-18/h2-3,6-7,9,11,15H,4-5,13H2,1H3 |
| InChIKey | BACYPQMPCOYXSY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine?
The IUPAC name of 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine (CID 80560812) is 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine.
What is the SMILES notation for 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine?
The canonical SMILES for 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine is Cc1ccc(NC2CC(N)C2)cc1-n1cnnn1.
What is the InChIKey of 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine?
The InChIKey is BACYPQMPCOYXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6/c1-8-2-3-10(15-11-4-9(13)5-11)6-12(8)18-7-14-16-17-18/h2-3,6-7,9,11,15H,4-5,13H2,1H3.
What are the key properties of 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine?
1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine has a molecular weight of 244.30 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[4-methyl-3-(tetrazol-1-yl)phenyl]cyclobutane-1,3-diamine is sourced from PubChem (CID 80560812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).