C15H22N2O — CID 80561247
3-amino-1-(1,2,3,4-tetrahydroisoquinolin-1-yl)cyclohexan-1-ol (PubChem CID 80561247) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-amino-1-(1,2,3,4-tetrahydroisoquinolin-1-yl)cyclohexan-1-ol.
| Compound Name | 3-amino-1-(1,2,3,4-tetrahydroisoquinolin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 80561247 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3-amino-1-(1,2,3,4-tetrahydroisoquinolin-1-yl)cyclohexan-1-ol |
| SMILES | NC1CCCC(O)(C2NCCc3ccccc32)C1 |
| InChI | InChI=1S/C15H22N2O/c16-12-5-3-8-15(18,10-12)14-13-6-2-1-4-11(13)7-9-17-14/h1-2,4,6,12,14,17-18H,3,5,7-10,16H2 |
| InChIKey | ROJVQFTZJVCYCP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |