C14H25NO3 — CID 80561361
3-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)cyclohexan-1-ol (PubChem CID 80561361) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)cyclohexan-1-ol.
| Compound Name | 3-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 80561361 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)cyclohexan-1-ol |
| SMILES | NC1CCCC(O)(C2CCOC3(CCOC3)C2)C1 |
| InChI | InChI=1S/C14H25NO3/c15-12-2-1-4-14(16,9-12)11-3-6-18-13(8-11)5-7-17-10-13/h11-12,16H,1-10,15H2 |
| InChIKey | FAPZJVXUNAVIAZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |