About 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine
1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine (PubChem CID 80562201) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine |
| PubChem CID | 80562201 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine |
| SMILES | CC(C)n1cc(NC2CC(N)C2)cn1 |
| InChI | InChI=1S/C10H18N4/c1-7(2)14-6-10(5-12-14)13-9-3-8(11)4-9/h5-9,13H,3-4,11H2,1-2H3 |
| InChIKey | NGWQKGOZOJGKSW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine?
The IUPAC name of 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine (CID 80562201) is 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine.
What is the SMILES notation for 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine?
The canonical SMILES for 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine is CC(C)n1cc(NC2CC(N)C2)cn1.
What is the InChIKey of 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine?
The InChIKey is NGWQKGOZOJGKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-7(2)14-6-10(5-12-14)13-9-3-8(11)4-9/h5-9,13H,3-4,11H2,1-2H3.
What are the key properties of 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine?
1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine has a molecular weight of 194.28 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1-propan-2-ylpyrazol-4-yl)cyclobutane-1,3-diamine is sourced from PubChem (CID 80562201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).