C22H20N2O — CID 805625
(2S)-2,3-bis(4-methylphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 805625) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S)-2,3-bis(4-methylphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2,3-bis(4-methylphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 805625 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2S)-2,3-bis(4-methylphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | Cc1ccc([C@H]2Nc3ccccc3C(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-15-7-11-17(12-8-15)21-23-20-6-4-3-5-19(20)22(25)24(21)18-13-9-16(2)10-14-18/h3-14,21,23H,1-2H3/t21-/m0/s1 |
| InChIKey | SCTYKXUVFITDHQ-NRFANRHFSA-N |
| XLogP | 5.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |