C17H19NO3 — CID 80562890
5-amino-1-(2,5-dimethoxyphenyl)-2,3-dihydroinden-1-ol (PubChem CID 80562890) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 5-amino-1-(2,5-dimethoxyphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-(2,5-dimethoxyphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562890 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 5-amino-1-(2,5-dimethoxyphenyl)-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc(OC)c(C2(O)CCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C17H19NO3/c1-20-13-4-6-16(21-2)15(10-13)17(19)8-7-11-9-12(18)3-5-14(11)17/h3-6,9-10,19H,7-8,18H2,1-2H3 |
| InChIKey | DPTNLFZPPNWMIG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|