C12H21N5O2 — CID 80564001
3-methyl-4-nitro-1-propan-2-yl-N-(pyrrolidin-3-ylmethyl)pyrazol-5-amine (PubChem CID 80564001) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-methyl-4-nitro-1-propan-2-yl-N-(pyrrolidin-3-ylmethyl)pyrazol-5-amine.
| Compound Name | 3-methyl-4-nitro-1-propan-2-yl-N-(pyrrolidin-3-ylmethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 80564001 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-methyl-4-nitro-1-propan-2-yl-N-(pyrrolidin-3-ylmethyl)pyrazol-5-amine |
| SMILES | Cc1nn(C(C)C)c(NCC2CCNC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H21N5O2/c1-8(2)16-12(11(17(18)19)9(3)15-16)14-7-10-4-5-13-6-10/h8,10,13-14H,4-7H2,1-3H3 |
| InChIKey | NWMFPGOJNPDDNN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|