C14H15N3O — CID 80565046
3-cyclobutyl-5-(2,3-dihydro-1H-indol-3-yl)-1,2,4-oxadiazole (PubChem CID 80565046) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-cyclobutyl-5-(2,3-dihydro-1H-indol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-cyclobutyl-5-(2,3-dihydro-1H-indol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 80565046 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-cyclobutyl-5-(2,3-dihydro-1H-indol-3-yl)-1,2,4-oxadiazole |
| SMILES | c1ccc2c(c1)NCC2c1nc(C2CCC2)no1 |
| InChI | InChI=1S/C14H15N3O/c1-2-7-12-10(6-1)11(8-15-12)14-16-13(17-18-14)9-4-3-5-9/h1-2,6-7,9,11,15H,3-5,8H2 |
| InChIKey | HCVFQVPDJBOWHX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |