C15H18N4 — CID 80566356
3-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-indole (PubChem CID 80566356) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-indole.
| Compound Name | 3-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 80566356 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-indole |
| SMILES | c1ccc2c(c1)NCC2c1nc(C2CCCC2)n[nH]1 |
| InChI | InChI=1S/C15H18N4/c1-2-6-10(5-1)14-17-15(19-18-14)12-9-16-13-8-4-3-7-11(12)13/h3-4,7-8,10,12,16H,1-2,5-6,9H2,(H,17,18,19) |
| InChIKey | UGGVADZGJQYIII-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |