About N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide
N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 80567255) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide |
| PubChem CID | 80567255 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(NC1CC=CCC1)C1CNc2ccccc21 |
| InChI | InChI=1S/C15H18N2O/c18-15(17-11-6-2-1-3-7-11)13-10-16-14-9-5-4-8-12(13)14/h1-2,4-5,8-9,11,13,16H,3,6-7,10H2,(H,17,18) |
| InChIKey | HDYKNNUONAMANP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide?
The IUPAC name of N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide (CID 80567255) is N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide.
What is the SMILES notation for N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide?
The canonical SMILES for N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide is O=C(NC1CC=CCC1)C1CNc2ccccc21.
What is the InChIKey of N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide?
The InChIKey is HDYKNNUONAMANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c18-15(17-11-6-2-1-3-7-11)13-10-16-14-9-5-4-8-12(13)14/h1-2,4-5,8-9,11,13,16H,3,6-7,10H2,(H,17,18).
What are the key properties of N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide?
N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide has a molecular weight of 242.32 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-3-en-1-yl-2,3-dihydro-1H-indole-3-carboxamide is sourced from PubChem (CID 80567255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).