C12H13N3O2S — CID 80567880
ethyl 2-(pyridin-2-ylmethylamino)-1,3-thiazole-4-carboxylate (PubChem CID 80567880) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl 2-(pyridin-2-ylmethylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(pyridin-2-ylmethylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80567880 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl 2-(pyridin-2-ylmethylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-11(16)10-8-18-12(15-10)14-7-9-5-3-4-6-13-9/h3-6,8H,2,7H2,1H3,(H,14,15) |
| InChIKey | NHXOMXMCIQVOPA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |