About 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid
2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 80568461) has the molecular formula C10H11N3O2S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 80568461 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1ncsc1CN(C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-6-8(17-5-11-6)3-13(2)10-12-7(4-16-10)9(14)15/h4-5H,3H2,1-2H3,(H,14,15) |
| InChIKey | FMXUYUCYESCTMZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid (CID 80568461) is 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid is Cc1ncsc1CN(C)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is FMXUYUCYESCTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S2/c1-6-8(17-5-11-6)3-13(2)10-12-7(4-16-10)9(14)15/h4-5H,3H2,1-2H3,(H,14,15).
What are the key properties of 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid?
2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 269.35 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 80568461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).