2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid

C12H12N2O2S — CID 80569053

IUPAC2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
SMILESCc1cccc(CNc2nc(C(=O)O)cs2)c1
InChIInChI=1S/C12H12N2O2S/c1-8-3-2-4-9(5-8)6-13-12-14-10(7-17-12)11(15)16/h2-5,7H,6H2,1H3,(H,13,14)(H,15,16)
InChIKeyXRECPGKLFZKDTB-UHFFFAOYSA-N
MW248.31 g/mol
LogP2.76
Rot. Bonds4

About 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid

2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 80569053) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
PubChem CID80569053
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
SMILESCc1cccc(CNc2nc(C(=O)O)cs2)c1
InChIInChI=1S/C12H12N2O2S/c1-8-3-2-4-9(5-8)6-13-12-14-10(7-17-12)11(15)16/h2-5,7H,6H2,1H3,(H,13,14)(H,15,16)
InChIKeyXRECPGKLFZKDTB-UHFFFAOYSA-N
XLogP2.76
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid (CID 80569053) is 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid is Cc1cccc(CNc2nc(C(=O)O)cs2)c1.
What is the InChIKey of 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is XRECPGKLFZKDTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-8-3-2-4-9(5-8)6-13-12-14-10(7-17-12)11(15)16/h2-5,7H,6H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 248.31 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methylphenyl)methylamino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 80569053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).