About 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid
4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80569676) has the molecular formula C10H11N3O2S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 80569676 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1ncc(CNc2nc(C)c(C(=O)O)s2)s1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-5-8(9(14)15)17-10(13-5)12-4-7-3-11-6(2)16-7/h3H,4H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | VCARHSNCDONLHQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid (CID 80569676) is 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid is Cc1ncc(CNc2nc(C)c(C(=O)O)s2)s1.
What is the InChIKey of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is VCARHSNCDONLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S2/c1-5-8(9(14)15)17-10(13-5)12-4-7-3-11-6(2)16-7/h3H,4H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid?
4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 269.35 g/mol, XLogP of 2.53, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80569676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).