C14H16N2O3S — CID 80569757
methyl 2-(3-ethoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 80569757) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 2-(3-ethoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-ethoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80569757 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 2-(3-ethoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOc1cccc(Nc2nc(C)c(C(=O)OC)s2)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-4-19-11-7-5-6-10(8-11)16-14-15-9(2)12(20-14)13(17)18-3/h5-8H,4H2,1-3H3,(H,15,16) |
| InChIKey | NGUQNTSJQDTUTP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |