C11H13N3O4S — CID 80570685
4-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80570685) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80570685 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(NC2CCC(=O)N(C)C2=O)sc1C(=O)O |
| InChI | InChI=1S/C11H13N3O4S/c1-5-8(10(17)18)19-11(12-5)13-6-3-4-7(15)14(2)9(6)16/h6H,3-4H2,1-2H3,(H,12,13)(H,17,18) |
| InChIKey | BAXGZPISPPOKSA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|