About methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate
methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate (PubChem CID 80570737) has the molecular formula C14H11N3O2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate |
| PubChem CID | 80570737 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cccc3ncccc23)s1 |
| InChI | InChI=1S/C14H11N3O2S/c1-19-13(18)12-8-16-14(20-12)17-11-6-2-5-10-9(11)4-3-7-15-10/h2-8H,1H3,(H,16,17) |
| InChIKey | UQLWTPNCEQFUJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate (CID 80570737) is methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate is COC(=O)c1cnc(Nc2cccc3ncccc23)s1.
What is the InChIKey of methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate?
The InChIKey is UQLWTPNCEQFUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S/c1-19-13(18)12-8-16-14(20-12)17-11-6-2-5-10-9(11)4-3-7-15-10/h2-8H,1H3,(H,16,17).
What are the key properties of methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate?
methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate has a molecular weight of 285.33 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(quinolin-5-ylamino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 80570737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).